C17H25NO2S — CID 175209892
4-methyl-1-(4-phenylsulfanylbutyl)piperidine-4-carboxylic acid (PubChem CID 175209892) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is 4-methyl-1-(4-phenylsulfanylbutyl)piperidine-4-carboxylic acid.
| Compound Name | 4-methyl-1-(4-phenylsulfanylbutyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 175209892 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 4-methyl-1-(4-phenylsulfanylbutyl)piperidine-4-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(CCCCSc2ccccc2)CC1 |
| InChI | InChI=1S/C17H25NO2S/c1-17(16(19)20)9-12-18(13-10-17)11-5-6-14-21-15-7-3-2-4-8-15/h2-4,7-8H,5-6,9-14H2,1H3,(H,19,20) |
| InChIKey | VOBKDXWXADGGGY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|