C17H26N2S — CID 170584124
7-(4-phenylsulfanylbutyl)-2,7-diazaspiro[3.5]nonane (PubChem CID 170584124) has the molecular formula C17H26N2S and a molecular weight of 290.48 g/mol. Its IUPAC name is 7-(4-phenylsulfanylbutyl)-2,7-diazaspiro[3.5]nonane.
| Compound Name | 7-(4-phenylsulfanylbutyl)-2,7-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 170584124 |
| Molecular Formula | C17H26N2S |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 7-(4-phenylsulfanylbutyl)-2,7-diazaspiro[3.5]nonane |
| SMILES | c1ccc(SCCCCN2CCC3(CC2)CNC3)cc1 |
| InChI | InChI=1S/C17H26N2S/c1-2-6-16(7-3-1)20-13-5-4-10-19-11-8-17(9-12-19)14-18-15-17/h1-3,6-7,18H,4-5,8-15H2 |
| InChIKey | XMGYSODTCBASOB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|