C22H25NO4 — CID 101363936
dimethyl (2R,4R)-4-benzyl-1-methyl-2-phenylpyrrolidine-3,3-dicarboxylate (PubChem CID 101363936) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is dimethyl (2R,4R)-4-benzyl-1-methyl-2-phenylpyrrolidine-3,3-dicarboxylate.
| Compound Name | dimethyl (2R,4R)-4-benzyl-1-methyl-2-phenylpyrrolidine-3,3-dicarboxylate |
|---|---|
| PubChem CID | 101363936 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | dimethyl (2R,4R)-4-benzyl-1-methyl-2-phenylpyrrolidine-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@@H](Cc2ccccc2)CN(C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H25NO4/c1-23-15-18(14-16-10-6-4-7-11-16)22(20(24)26-2,21(25)27-3)19(23)17-12-8-5-9-13-17/h4-13,18-19H,14-15H2,1-3H3/t18-,19+/m0/s1 |
| InChIKey | UTFDKHSEPBZGLO-RBUKOAKNSA-N |
| XLogP | 2.86 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|