C20H21NO3 — CID 101459715
methyl (3S,3aS,9bR)-1-methyl-3-phenyl-2,3,4,9b-tetrahydrochromeno[4,3-b]pyrrole-3a-carboxylate (PubChem CID 101459715) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is methyl (3S,3aS,9bR)-1-methyl-3-phenyl-2,3,4,9b-tetrahydrochromeno[4,3-b]pyrrole-3a-carboxylate.
| Compound Name | methyl (3S,3aS,9bR)-1-methyl-3-phenyl-2,3,4,9b-tetrahydrochromeno[4,3-b]pyrrole-3a-carboxylate |
|---|---|
| PubChem CID | 101459715 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | methyl (3S,3aS,9bR)-1-methyl-3-phenyl-2,3,4,9b-tetrahydrochromeno[4,3-b]pyrrole-3a-carboxylate |
| SMILES | COC(=O)[C@]12COc3ccccc3[C@H]1N(C)C[C@H]2c1ccccc1 |
| InChI | InChI=1S/C20H21NO3/c1-21-12-16(14-8-4-3-5-9-14)20(19(22)23-2)13-24-17-11-7-6-10-15(17)18(20)21/h3-11,16,18H,12-13H2,1-2H3/t16-,18+,20-/m0/s1 |
| InChIKey | KGRHLLNRVQEGEC-HQRMLTQVSA-N |
| XLogP | 3.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |