C24H22O5 — CID 102422377
methyl (6aS,7S,12bS)-12-oxo-7-phenyl-6,7,9,10,11,12b-hexahydrochromeno[3,4-c]chromene-6a-carboxylate (PubChem CID 102422377) has the molecular formula C24H22O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is methyl (6aS,7S,12bS)-12-oxo-7-phenyl-6,7,9,10,11,12b-hexahydrochromeno[3,4-c]chromene-6a-carboxylate.
| Compound Name | methyl (6aS,7S,12bS)-12-oxo-7-phenyl-6,7,9,10,11,12b-hexahydrochromeno[3,4-c]chromene-6a-carboxylate |
|---|---|
| PubChem CID | 102422377 |
| Molecular Formula | C24H22O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | methyl (6aS,7S,12bS)-12-oxo-7-phenyl-6,7,9,10,11,12b-hexahydrochromeno[3,4-c]chromene-6a-carboxylate |
| SMILES | COC(=O)[C@]12COc3ccccc3[C@H]1C1=C(CCCC1=O)O[C@H]2c1ccccc1 |
| InChI | InChI=1S/C24H22O5/c1-27-23(26)24-14-28-18-12-6-5-10-16(18)21(24)20-17(25)11-7-13-19(20)29-22(24)15-8-3-2-4-9-15/h2-6,8-10,12,21-22H,7,11,13-14H2,1H3/t21-,22-,24+/m0/s1 |
| InChIKey | TYWPSEDYSQWOAJ-WPFOTENUSA-N |
| XLogP | 4.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |