C18H18O5 — CID 12022410
dimethyl (1R,2S,10S,11R)-9-oxatetracyclo[9.2.2.02,10.03,8]pentadeca-3,5,7,12-tetraene-12,13-dicarboxylate (PubChem CID 12022410) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is dimethyl (1R,2S,10S,11R)-9-oxatetracyclo[9.2.2.02,10.03,8]pentadeca-3,5,7,12-tetraene-12,13-dicarboxylate.
| Compound Name | dimethyl (1R,2S,10S,11R)-9-oxatetracyclo[9.2.2.02,10.03,8]pentadeca-3,5,7,12-tetraene-12,13-dicarboxylate |
|---|---|
| PubChem CID | 12022410 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | dimethyl (1R,2S,10S,11R)-9-oxatetracyclo[9.2.2.02,10.03,8]pentadeca-3,5,7,12-tetraene-12,13-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H]2CC[C@H]1[C@@H]1Oc3ccccc3[C@@H]12 |
| InChI | InChI=1S/C18H18O5/c1-21-17(19)14-10-7-8-11(15(14)18(20)22-2)16-13(10)9-5-3-4-6-12(9)23-16/h3-6,10-11,13,16H,7-8H2,1-2H3/t10-,11-,13-,16+/m1/s1 |
| InChIKey | FDVONWHVFDJWSZ-MSIPSHCFSA-N |
| XLogP | 2.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |