C14H19NO2 — CID 150173428
methyl (2R,3S)-1-methyl-2-phenylpiperidine-3-carboxylate (PubChem CID 150173428) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is methyl (2R,3S)-1-methyl-2-phenylpiperidine-3-carboxylate.
| Compound Name | methyl (2R,3S)-1-methyl-2-phenylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 150173428 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | methyl (2R,3S)-1-methyl-2-phenylpiperidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN(C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H19NO2/c1-15-10-6-9-12(14(16)17-2)13(15)11-7-4-3-5-8-11/h3-5,7-8,12-13H,6,9-10H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | FJXKCGPXKCKSBZ-STQMWFEESA-N |
| XLogP | 2.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |