C14H17NO5 — CID 102334992
dimethyl (2R,4R,5R)-1-hydroxy-5-phenylpyrrolidine-2,4-dicarboxylate (PubChem CID 102334992) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is dimethyl (2R,4R,5R)-1-hydroxy-5-phenylpyrrolidine-2,4-dicarboxylate.
| Compound Name | dimethyl (2R,4R,5R)-1-hydroxy-5-phenylpyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 102334992 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | dimethyl (2R,4R,5R)-1-hydroxy-5-phenylpyrrolidine-2,4-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](C(=O)OC)[C@H](c2ccccc2)N1O |
| InChI | InChI=1S/C14H17NO5/c1-19-13(16)10-8-11(14(17)20-2)15(18)12(10)9-6-4-3-5-7-9/h3-7,10-12,18H,8H2,1-2H3/t10-,11-,12+/m1/s1 |
| InChIKey | HOWFUMGBCZXYHS-UTUOFQBUSA-N |
| XLogP | 1.15 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |