C44H42N4NiO10S2 — CID 135857407
bis((2R,3S,5S)-N-benzoyl-3,5-bis(methoxycarbonyl)-2-phenylpyrrolidine-1-carboximidothioate);nickel(2+) (PubChem CID 135857407) has the molecular formula C44H42N4NiO10S2 and a molecular weight of 909.67 g/mol. Its IUPAC name is bis((2R,3S,5S)-N-benzoyl-3,5-bis(methoxycarbonyl)-2-phenylpyrrolidine-1-carboximidothioate);nickel(2+).
| Compound Name | bis((2R,3S,5S)-N-benzoyl-3,5-bis(methoxycarbonyl)-2-phenylpyrrolidine-1-carboximidothioate);nickel(2+) |
|---|---|
| PubChem CID | 135857407 |
| Molecular Formula | C44H42N4NiO10S2 |
| Molecular Weight | 909.67 g/mol |
| Exact Mass | 908.17 |
| IUPAC Name | bis((2R,3S,5S)-N-benzoyl-3,5-bis(methoxycarbonyl)-2-phenylpyrrolidine-1-carboximidothioate);nickel(2+) |
| SMILES | COC(=O)[C@H]1C[C@@H](C(=O)OC)N(/C([S-])=N/C(=O)c2ccccc2)[C@H]1c1ccccc1.COC(=O)[C@H]1C[C@@H](C(=O)OC)N(/C([S-])=N\C(=O)c2ccccc2)[C@H]1c1ccccc1.[Ni+2] |
| InChI | InChI=1S/2C22H22N2O5S.Ni/c2*1-28-20(26)16-13-17(21(27)29-2)24(18(16)14-9-5-3-6-10-14)22(30)23-19(25)15-11-7-4-8-12-15;/h2*3-12,16-18H,13H2,1-2H3,(H,23,25,30);/q;;+2/p-2/t2*16-,17-,18-;/m00./s1 |
| InChIKey | DUBCQRROLKCSTH-WUKKFQIASA-L |
| XLogP | 5.01 |
| TPSA | 170.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.67 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|