C18H22N2O2 — CID 101386797
methyl (1S,3R,4S,6S)-3-methyl-2-(N-methyl-C-phenylcarbonimidoyl)-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate (PubChem CID 101386797) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is methyl (1S,3R,4S,6S)-3-methyl-2-(N-methyl-C-phenylcarbonimidoyl)-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate.
| Compound Name | methyl (1S,3R,4S,6S)-3-methyl-2-(N-methyl-C-phenylcarbonimidoyl)-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate |
|---|---|
| PubChem CID | 101386797 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | methyl (1S,3R,4S,6S)-3-methyl-2-(N-methyl-C-phenylcarbonimidoyl)-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate |
| SMILES | C/N=C(\c1ccccc1)N1[C@H](C)[C@@H]2C=C[C@H]1[C@@H](C(=O)OC)C2 |
| InChI | InChI=1S/C18H22N2O2/c1-12-14-9-10-16(15(11-14)18(21)22-3)20(12)17(19-2)13-7-5-4-6-8-13/h4-10,12,14-16H,11H2,1-3H3/b19-17+/t12-,14-,15+,16+/m1/s1 |
| InChIKey | CIOIQAIOWBHKHZ-UUXARHKXSA-N |
| XLogP | 2.50 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|