C31H42N2O2 — CID 122577863
methyl N-[4-[[4-[[methoxy(phenyl)methylidene]amino]-3-methylcyclohexyl]methyl]-2-methylcyclohexyl]benzenecarboximidate (PubChem CID 122577863) has the molecular formula C31H42N2O2 and a molecular weight of 474.69 g/mol. Its IUPAC name is methyl N-[4-[[4-[[methoxy(phenyl)methylidene]amino]-3-methylcyclohexyl]methyl]-2-methylcyclohexyl]benzenecarboximidate.
| Compound Name | methyl N-[4-[[4-[[methoxy(phenyl)methylidene]amino]-3-methylcyclohexyl]methyl]-2-methylcyclohexyl]benzenecarboximidate |
|---|---|
| PubChem CID | 122577863 |
| Molecular Formula | C31H42N2O2 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | methyl N-[4-[[4-[[methoxy(phenyl)methylidene]amino]-3-methylcyclohexyl]methyl]-2-methylcyclohexyl]benzenecarboximidate |
| SMILES | CO/C(=N\C1CCC(CC2CCC(/N=C(\OC)c3ccccc3)C(C)C2)CC1C)c1ccccc1 |
| InChI | InChI=1S/C31H42N2O2/c1-22-19-24(15-17-28(22)32-30(34-3)26-11-7-5-8-12-26)21-25-16-18-29(23(2)20-25)33-31(35-4)27-13-9-6-10-14-27/h5-14,22-25,28-29H,15-21H2,1-4H3/b32-30-,33-31- |
| InChIKey | ROMYZNNUKJCGJK-UOALMSBLSA-N |
| XLogP | 7.17 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|