C12H12N2O — CID 11571974
methyl N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate (PubChem CID 11571974) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is methyl N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate.
| Compound Name | methyl N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate |
|---|---|
| PubChem CID | 11571974 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | methyl N-[(1S,2S)-2-cyanocyclopropyl]benzenecarboximidate |
| SMILES | CO/C(=N\[C@H]1C[C@@H]1C#N)c1ccccc1 |
| InChI | InChI=1S/C12H12N2O/c1-15-12(9-5-3-2-4-6-9)14-11-7-10(11)8-13/h2-6,10-11H,7H2,1H3/b14-12-/t10-,11+/m1/s1 |
| InChIKey | VMDMGWVQDNEYCS-BBMDBWOGSA-N |
| XLogP | 1.99 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|