About cis-methyl (3R,4S)-3-cyano-4-hydroxycyclopentane-1-carboxylate
cis-methyl (3R,4S)-3-cyano-4-hydroxycyclopentane-1-carboxylate (PubChem CID 58826450) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is cis-methyl (3R,4S)-3-cyano-4-hydroxycyclopentane-1-carboxylate.
Analyze cis-methyl (3R,4S)-3-cyano-4-hydroxycyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-methyl (3R,4S)-3-cyano-4-hydroxycyclopentane-1-carboxylate?
The IUPAC name of cis-methyl (3R,4S)-3-cyano-4-hydroxycyclopentane-1-carboxylate (CID 58826450) is cis-methyl (3R,4S)-3-cyano-4-hydroxycyclopentane-1-carboxylate.
What is the SMILES notation for cis-methyl (3R,4S)-3-cyano-4-hydroxycyclopentane-1-carboxylate?
The canonical SMILES for cis-methyl (3R,4S)-3-cyano-4-hydroxycyclopentane-1-carboxylate is COC(=O)C1C[C@H](O)[C@@H](C#N)C1.
What is the InChIKey of cis-methyl (3R,4S)-3-cyano-4-hydroxycyclopentane-1-carboxylate?
The InChIKey is LOSHHXLYNZIPRR-FWPZAIACSA-N. The full InChI is InChI=1S/C8H11NO3/c1-12-8(11)5-2-6(4-9)7(10)3-5/h5-7,10H,2-3H2,1H3/t5?,6-,7+/m1/s1.
What are the key properties of cis-methyl (3R,4S)-3-cyano-4-hydroxycyclopentane-1-carboxylate?
cis-methyl (3R,4S)-3-cyano-4-hydroxycyclopentane-1-carboxylate has a molecular weight of 169.18 g/mol, XLogP of 0.07, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-methyl (3R,4S)-3-cyano-4-hydroxycyclopentane-1-carboxylate is sourced from PubChem (CID 58826450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).