C8H11NO2 — CID 102427943
cis-methyl (1R,2R)-2-cyanocyclopentane-1-carboxylate (PubChem CID 102427943) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is cis-methyl (1R,2R)-2-cyanocyclopentane-1-carboxylate.
| Compound Name | cis-methyl (1R,2R)-2-cyanocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 102427943 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | cis-methyl (1R,2R)-2-cyanocyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CCC[C@H]1C#N |
| InChI | InChI=1S/C8H11NO2/c1-11-8(10)7-4-2-3-6(7)5-9/h6-7H,2-4H2,1H3/t6-,7+/m0/s1 |
| InChIKey | NKSIVXUEGBZILF-NKWVEPMBSA-N |
| XLogP | 1.10 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |