C11H20O5 — CID 121285425
methyl 3,4,5-trimethoxycyclohexane-1-carboxylate (PubChem CID 121285425) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is methyl 3,4,5-trimethoxycyclohexane-1-carboxylate.
| Compound Name | methyl 3,4,5-trimethoxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 121285425 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | methyl 3,4,5-trimethoxycyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CC(OC)C(OC)C(OC)C1 |
| InChI | InChI=1S/C11H20O5/c1-13-8-5-7(11(12)16-4)6-9(14-2)10(8)15-3/h7-10H,5-6H2,1-4H3 |
| InChIKey | FPJNKBYJLLHTBF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |