C9H15NO6 — CID 46220209
methyl (1S,3R,4R)-3-methoxy-4-nitrooxycyclohexane-1-carboxylate (PubChem CID 46220209) has the molecular formula C9H15NO6 and a molecular weight of 233.22 g/mol. Its IUPAC name is methyl (1S,3R,4R)-3-methoxy-4-nitrooxycyclohexane-1-carboxylate.
| Compound Name | methyl (1S,3R,4R)-3-methoxy-4-nitrooxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 46220209 |
| Molecular Formula | C9H15NO6 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | methyl (1S,3R,4R)-3-methoxy-4-nitrooxycyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@H]1CC[C@@H](O[N+](=O)[O-])[C@H](OC)C1 |
| InChI | InChI=1S/C9H15NO6/c1-14-8-5-6(9(11)15-2)3-4-7(8)16-10(12)13/h6-8H,3-5H2,1-2H3/t6-,7+,8+/m0/s1 |
| InChIKey | SQXMQQYPQZFDHG-XLPZGREQSA-N |
| XLogP | 0.55 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|