C7H12N2O5 — CID 67399133
[(1R,2R,4S)-4-carbamoyl-2-methoxycyclopentyl] nitrate (PubChem CID 67399133) has the molecular formula C7H12N2O5 and a molecular weight of 204.18 g/mol. Its IUPAC name is [(1R,2R,4S)-4-carbamoyl-2-methoxycyclopentyl] nitrate.
| Compound Name | [(1R,2R,4S)-4-carbamoyl-2-methoxycyclopentyl] nitrate |
|---|---|
| PubChem CID | 67399133 |
| Molecular Formula | C7H12N2O5 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | [(1R,2R,4S)-4-carbamoyl-2-methoxycyclopentyl] nitrate |
| SMILES | CO[C@@H]1C[C@H](C(N)=O)C[C@H]1O[N+](=O)[O-] |
| InChI | InChI=1S/C7H12N2O5/c1-13-5-2-4(7(8)10)3-6(5)14-9(11)12/h4-6H,2-3H2,1H3,(H2,8,10)/t4-,5+,6+/m0/s1 |
| InChIKey | UKFLULOKRWPLSR-KVQBGUIXSA-N |
| XLogP | -0.53 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|