[(1R,2R,4S)-4-carbamoyl-2-methoxycyclopentyl] nitrate

C7H12N2O5 — CID 67399133

IUPAC[(1R,2R,4S)-4-carbamoyl-2-methoxycyclopentyl] nitrate
SMILESCO[C@@H]1C[C@H](C(N)=O)C[C@H]1O[N+](=O)[O-]
InChIInChI=1S/C7H12N2O5/c1-13-5-2-4(7(8)10)3-6(5)14-9(11)12/h4-6H,2-3H2,1H3,(H2,8,10)/t4-,5+,6+/m0/s1
InChIKeyUKFLULOKRWPLSR-KVQBGUIXSA-N
MW204.18 g/mol
LogP-0.53
Rot. Bonds4

About [(1R,2R,4S)-4-carbamoyl-2-methoxycyclopentyl] nitrate

[(1R,2R,4S)-4-carbamoyl-2-methoxycyclopentyl] nitrate (PubChem CID 67399133) has the molecular formula C7H12N2O5 and a molecular weight of 204.18 g/mol. Its IUPAC name is [(1R,2R,4S)-4-carbamoyl-2-methoxycyclopentyl] nitrate.

Molecular Properties

Compound Name[(1R,2R,4S)-4-carbamoyl-2-methoxycyclopentyl] nitrate
PubChem CID67399133
Molecular FormulaC7H12N2O5
Molecular Weight204.18 g/mol
Exact Mass204.07
IUPAC Name[(1R,2R,4S)-4-carbamoyl-2-methoxycyclopentyl] nitrate
SMILESCO[C@@H]1C[C@H](C(N)=O)C[C@H]1O[N+](=O)[O-]
InChIInChI=1S/C7H12N2O5/c1-13-5-2-4(7(8)10)3-6(5)14-9(11)12/h4-6H,2-3H2,1H3,(H2,8,10)/t4-,5+,6+/m0/s1
InChIKeyUKFLULOKRWPLSR-KVQBGUIXSA-N
XLogP-0.53
TPSA104.69 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.18
LogP ≤ 5-0.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze [(1R,2R,4S)-4-carbamoyl-2-methoxycyclopentyl] nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(1R,2R,4S)-4-carbamoyl-2-methoxycyclopentyl] nitrate?
The IUPAC name of [(1R,2R,4S)-4-carbamoyl-2-methoxycyclopentyl] nitrate (CID 67399133) is [(1R,2R,4S)-4-carbamoyl-2-methoxycyclopentyl] nitrate.
What is the SMILES notation for [(1R,2R,4S)-4-carbamoyl-2-methoxycyclopentyl] nitrate?
The canonical SMILES for [(1R,2R,4S)-4-carbamoyl-2-methoxycyclopentyl] nitrate is CO[C@@H]1C[C@H](C(N)=O)C[C@H]1O[N+](=O)[O-].
What is the InChIKey of [(1R,2R,4S)-4-carbamoyl-2-methoxycyclopentyl] nitrate?
The InChIKey is UKFLULOKRWPLSR-KVQBGUIXSA-N. The full InChI is InChI=1S/C7H12N2O5/c1-13-5-2-4(7(8)10)3-6(5)14-9(11)12/h4-6H,2-3H2,1H3,(H2,8,10)/t4-,5+,6+/m0/s1.
What are the key properties of [(1R,2R,4S)-4-carbamoyl-2-methoxycyclopentyl] nitrate?
[(1R,2R,4S)-4-carbamoyl-2-methoxycyclopentyl] nitrate has a molecular weight of 204.18 g/mol, XLogP of -0.53, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R,4S)-4-carbamoyl-2-methoxycyclopentyl] nitrate is sourced from PubChem (CID 67399133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).