C10H18N3O5- — CID 10220848
(3-carbamoyl-2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl) nitrate (PubChem CID 10220848) has the molecular formula C10H18N3O5- and a molecular weight of 260.27 g/mol. Its IUPAC name is (3-carbamoyl-2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl) nitrate.
| Compound Name | (3-carbamoyl-2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl) nitrate |
|---|---|
| PubChem CID | 10220848 |
| Molecular Formula | C10H18N3O5- |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (3-carbamoyl-2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl) nitrate |
| SMILES | CC1(C)CC(O[N+](=O)[O-])C(C(N)=O)C(C)(C)N1[O-] |
| InChI | InChI=1S/C10H18N3O5/c1-9(2)5-6(18-13(16)17)7(8(11)14)10(3,4)12(9)15/h6-7H,5H2,1-4H3,(H2,11,14)/q-1 |
| InChIKey | QTIFJJSOCPRHCT-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|