C10H18N2O5 — CID 85469840
(2,2,5,5-tetramethyl-3-nitrooxypyrrolidin-1-yl) acetate (PubChem CID 85469840) has the molecular formula C10H18N2O5 and a molecular weight of 246.26 g/mol. Its IUPAC name is (2,2,5,5-tetramethyl-3-nitrooxypyrrolidin-1-yl) acetate.
| Compound Name | (2,2,5,5-tetramethyl-3-nitrooxypyrrolidin-1-yl) acetate |
|---|---|
| PubChem CID | 85469840 |
| Molecular Formula | C10H18N2O5 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | (2,2,5,5-tetramethyl-3-nitrooxypyrrolidin-1-yl) acetate |
| SMILES | CC(=O)ON1C(C)(C)CC(O[N+](=O)[O-])C1(C)C |
| InChI | InChI=1S/C10H18N2O5/c1-7(13)16-11-9(2,3)6-8(10(11,4)5)17-12(14)15/h8H,6H2,1-5H3 |
| InChIKey | HHDMBGBFSFMPFG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|