C13H22N2O7 — CID 85470233
1-acetyloxy-2,2,6,6-tetramethyl-3-(nitrooxymethyl)piperidine-4-carboxylic acid (PubChem CID 85470233) has the molecular formula C13H22N2O7 and a molecular weight of 318.33 g/mol. Its IUPAC name is 1-acetyloxy-2,2,6,6-tetramethyl-3-(nitrooxymethyl)piperidine-4-carboxylic acid.
| Compound Name | 1-acetyloxy-2,2,6,6-tetramethyl-3-(nitrooxymethyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 85470233 |
| Molecular Formula | C13H22N2O7 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-acetyloxy-2,2,6,6-tetramethyl-3-(nitrooxymethyl)piperidine-4-carboxylic acid |
| SMILES | CC(=O)ON1C(C)(C)CC(C(=O)O)C(CO[N+](=O)[O-])C1(C)C |
| InChI | InChI=1S/C13H22N2O7/c1-8(16)22-14-12(2,3)6-9(11(17)18)10(13(14,4)5)7-21-15(19)20/h9-10H,6-7H2,1-5H3,(H,17,18) |
| InChIKey | SILMLVIZOPZCNZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|