C12H21N3O8 — CID 85469903
(2,2,6,6-tetramethyl-3,4-dinitrooxypiperidin-1-yl) propanoate (PubChem CID 85469903) has the molecular formula C12H21N3O8 and a molecular weight of 335.31 g/mol. Its IUPAC name is (2,2,6,6-tetramethyl-3,4-dinitrooxypiperidin-1-yl) propanoate.
| Compound Name | (2,2,6,6-tetramethyl-3,4-dinitrooxypiperidin-1-yl) propanoate |
|---|---|
| PubChem CID | 85469903 |
| Molecular Formula | C12H21N3O8 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (2,2,6,6-tetramethyl-3,4-dinitrooxypiperidin-1-yl) propanoate |
| SMILES | CCC(=O)ON1C(C)(C)CC(O[N+](=O)[O-])C(O[N+](=O)[O-])C1(C)C |
| InChI | InChI=1S/C12H21N3O8/c1-6-9(16)22-13-11(2,3)7-8(21-14(17)18)10(12(13,4)5)23-15(19)20/h8,10H,6-7H2,1-5H3 |
| InChIKey | DRKQEBBYDGTFBX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|