(4-methyl-2-nitrooxycyclopentyl) nitrate

C6H10N2O6 — CID 143811821

IUPAC(4-methyl-2-nitrooxycyclopentyl) nitrate
SMILESCC1CC(O[N+](=O)[O-])C(O[N+](=O)[O-])C1
InChIInChI=1S/C6H10N2O6/c1-4-2-5(13-7(9)10)6(3-4)14-8(11)12/h4-6H,2-3H2,1H3
InChIKeyFYUVCPDWHKQNDE-UHFFFAOYSA-N
MW206.15 g/mol
LogP0.57
Rot. Bonds4

About (4-methyl-2-nitrooxycyclopentyl) nitrate

(4-methyl-2-nitrooxycyclopentyl) nitrate (PubChem CID 143811821) has the molecular formula C6H10N2O6 and a molecular weight of 206.15 g/mol. Its IUPAC name is (4-methyl-2-nitrooxycyclopentyl) nitrate.

Molecular Properties

Compound Name(4-methyl-2-nitrooxycyclopentyl) nitrate
PubChem CID143811821
Molecular FormulaC6H10N2O6
Molecular Weight206.15 g/mol
Exact Mass206.05
IUPAC Name(4-methyl-2-nitrooxycyclopentyl) nitrate
SMILESCC1CC(O[N+](=O)[O-])C(O[N+](=O)[O-])C1
InChIInChI=1S/C6H10N2O6/c1-4-2-5(13-7(9)10)6(3-4)14-8(11)12/h4-6H,2-3H2,1H3
InChIKeyFYUVCPDWHKQNDE-UHFFFAOYSA-N
XLogP0.57
TPSA104.74 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.15
LogP ≤ 50.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (4-methyl-2-nitrooxycyclopentyl) nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-methyl-2-nitrooxycyclopentyl) nitrate?
The IUPAC name of (4-methyl-2-nitrooxycyclopentyl) nitrate (CID 143811821) is (4-methyl-2-nitrooxycyclopentyl) nitrate.
What is the SMILES notation for (4-methyl-2-nitrooxycyclopentyl) nitrate?
The canonical SMILES for (4-methyl-2-nitrooxycyclopentyl) nitrate is CC1CC(O[N+](=O)[O-])C(O[N+](=O)[O-])C1.
What is the InChIKey of (4-methyl-2-nitrooxycyclopentyl) nitrate?
The InChIKey is FYUVCPDWHKQNDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O6/c1-4-2-5(13-7(9)10)6(3-4)14-8(11)12/h4-6H,2-3H2,1H3.
What are the key properties of (4-methyl-2-nitrooxycyclopentyl) nitrate?
(4-methyl-2-nitrooxycyclopentyl) nitrate has a molecular weight of 206.15 g/mol, XLogP of 0.57, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-2-nitrooxycyclopentyl) nitrate is sourced from PubChem (CID 143811821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).