C15H30N2O4 — CID 126753011
(4,5-diethyl-1-hydroxy-2,2,7,7-tetramethylazepan-3-yl)methyl nitrate (PubChem CID 126753011) has the molecular formula C15H30N2O4 and a molecular weight of 302.42 g/mol. Its IUPAC name is (4,5-diethyl-1-hydroxy-2,2,7,7-tetramethylazepan-3-yl)methyl nitrate.
| Compound Name | (4,5-diethyl-1-hydroxy-2,2,7,7-tetramethylazepan-3-yl)methyl nitrate |
|---|---|
| PubChem CID | 126753011 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (4,5-diethyl-1-hydroxy-2,2,7,7-tetramethylazepan-3-yl)methyl nitrate |
| SMILES | CCC1CC(C)(C)N(O)C(C)(C)C(CO[N+](=O)[O-])C1CC |
| InChI | InChI=1S/C15H30N2O4/c1-7-11-9-14(3,4)16(18)15(5,6)13(12(11)8-2)10-21-17(19)20/h11-13,18H,7-10H2,1-6H3 |
| InChIKey | IVKVHGJQWNDBHS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|