C14H23N3O4S — CID 11659932
2-[2-(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate (PubChem CID 11659932) has the molecular formula C14H23N3O4S and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-[2-(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate.
| Compound Name | 2-[2-(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate |
|---|---|
| PubChem CID | 11659932 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-[2-(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate |
| SMILES | Cc1nc(C2CC(C)(C)N(O)C2(C)C)sc1CCO[N+](=O)[O-] |
| InChI | InChI=1S/C14H23N3O4S/c1-9-11(6-7-21-17(19)20)22-12(15-9)10-8-13(2,3)16(18)14(10,4)5/h10,18H,6-8H2,1-5H3 |
| InChIKey | LOUYWJQKECWDQU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|