C18H26N2O5S — CID 143129410
ethane;2-[2-[4-(2-methoxyethoxymethyl)phenyl]-4-methyl-1,3-thiazol-5-yl]ethyl nitrate (PubChem CID 143129410) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is ethane;2-[2-[4-(2-methoxyethoxymethyl)phenyl]-4-methyl-1,3-thiazol-5-yl]ethyl nitrate.
| Compound Name | ethane;2-[2-[4-(2-methoxyethoxymethyl)phenyl]-4-methyl-1,3-thiazol-5-yl]ethyl nitrate |
|---|---|
| PubChem CID | 143129410 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | ethane;2-[2-[4-(2-methoxyethoxymethyl)phenyl]-4-methyl-1,3-thiazol-5-yl]ethyl nitrate |
| SMILES | CC.COCCOCc1ccc(-c2nc(C)c(CCO[N+](=O)[O-])s2)cc1 |
| InChI | InChI=1S/C16H20N2O5S.C2H6/c1-12-15(7-8-23-18(19)20)24-16(17-12)14-5-3-13(4-6-14)11-22-10-9-21-2;1-2/h3-6H,7-11H2,1-2H3;1-2H3 |
| InChIKey | HGRMGQHWDAADSN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|