2-(4-methylphenyl)ethyl nitrate

C9H11NO3 — CID 54378614

IUPAC2-(4-methylphenyl)ethyl nitrate
SMILESCc1ccc(CCO[N+](=O)[O-])cc1
InChIInChI=1S/C9H11NO3/c1-8-2-4-9(5-3-8)6-7-13-10(11)12/h2-5H,6-7H2,1H3
InChIKeyUYIIPKYMVBTPFJ-UHFFFAOYSA-N
MW181.19 g/mol
LogP1.75
Rot. Bonds4

About 2-(4-methylphenyl)ethyl nitrate

2-(4-methylphenyl)ethyl nitrate (PubChem CID 54378614) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-(4-methylphenyl)ethyl nitrate.

Molecular Properties

Compound Name2-(4-methylphenyl)ethyl nitrate
PubChem CID54378614
Molecular FormulaC9H11NO3
Molecular Weight181.19 g/mol
Exact Mass181.07
IUPAC Name2-(4-methylphenyl)ethyl nitrate
SMILESCc1ccc(CCO[N+](=O)[O-])cc1
InChIInChI=1S/C9H11NO3/c1-8-2-4-9(5-3-8)6-7-13-10(11)12/h2-5H,6-7H2,1H3
InChIKeyUYIIPKYMVBTPFJ-UHFFFAOYSA-N
XLogP1.75
TPSA52.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.19
LogP ≤ 51.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(4-methylphenyl)ethyl nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-methylphenyl)ethyl nitrate?
The IUPAC name of 2-(4-methylphenyl)ethyl nitrate (CID 54378614) is 2-(4-methylphenyl)ethyl nitrate.
What is the SMILES notation for 2-(4-methylphenyl)ethyl nitrate?
The canonical SMILES for 2-(4-methylphenyl)ethyl nitrate is Cc1ccc(CCO[N+](=O)[O-])cc1.
What is the InChIKey of 2-(4-methylphenyl)ethyl nitrate?
The InChIKey is UYIIPKYMVBTPFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c1-8-2-4-9(5-3-8)6-7-13-10(11)12/h2-5H,6-7H2,1H3.
What are the key properties of 2-(4-methylphenyl)ethyl nitrate?
2-(4-methylphenyl)ethyl nitrate has a molecular weight of 181.19 g/mol, XLogP of 1.75, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)ethyl nitrate is sourced from PubChem (CID 54378614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).