About 3-(3-methylphenyl)propyl nitrate
3-(3-methylphenyl)propyl nitrate (PubChem CID 145116632) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-(3-methylphenyl)propyl nitrate.
Molecular Properties
| Compound Name | 3-(3-methylphenyl)propyl nitrate |
| PubChem CID | 145116632 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 3-(3-methylphenyl)propyl nitrate |
| SMILES | Cc1cccc(CCCO[N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H13NO3/c1-9-4-2-5-10(8-9)6-3-7-14-11(12)13/h2,4-5,8H,3,6-7H2,1H3 |
| InChIKey | WYQKOOVZXIJPOV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-methylphenyl)propyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methylphenyl)propyl nitrate?
The IUPAC name of 3-(3-methylphenyl)propyl nitrate (CID 145116632) is 3-(3-methylphenyl)propyl nitrate.
What is the SMILES notation for 3-(3-methylphenyl)propyl nitrate?
The canonical SMILES for 3-(3-methylphenyl)propyl nitrate is Cc1cccc(CCCO[N+](=O)[O-])c1.
What is the InChIKey of 3-(3-methylphenyl)propyl nitrate?
The InChIKey is WYQKOOVZXIJPOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c1-9-4-2-5-10(8-9)6-3-7-14-11(12)13/h2,4-5,8H,3,6-7H2,1H3.
What are the key properties of 3-(3-methylphenyl)propyl nitrate?
3-(3-methylphenyl)propyl nitrate has a molecular weight of 195.22 g/mol, XLogP of 2.14, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methylphenyl)propyl nitrate is sourced from PubChem (CID 145116632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).