C16H20N2O5S — CID 143129381
2-[2-(1,3-benzodioxol-5-ylmethyl)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate;ethane (PubChem CID 143129381) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-ylmethyl)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate;ethane.
| Compound Name | 2-[2-(1,3-benzodioxol-5-ylmethyl)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate;ethane |
|---|---|
| PubChem CID | 143129381 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-ylmethyl)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate;ethane |
| SMILES | CC.Cc1nc(Cc2ccc3c(c2)OCO3)sc1CCO[N+](=O)[O-] |
| InChI | InChI=1S/C14H14N2O5S.C2H6/c1-9-13(4-5-21-16(17)18)22-14(15-9)7-10-2-3-11-12(6-10)20-8-19-11;1-2/h2-3,6H,4-5,7-8H2,1H3;1-2H3 |
| InChIKey | AHFFSLCKBYZCNR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|