C16H14Cl2N2O3S — CID 29427798
(1R)-N-[5-(1,3-benzodioxol-5-ylmethyl)-4-methyl-1,3-thiazol-2-yl]-2,2-dichlorocyclopropane-1-carboxamide (PubChem CID 29427798) has the molecular formula C16H14Cl2N2O3S and a molecular weight of 385.27 g/mol. Its IUPAC name is (1R)-N-[5-(1,3-benzodioxol-5-ylmethyl)-4-methyl-1,3-thiazol-2-yl]-2,2-dichlorocyclopropane-1-carboxamide.
| Compound Name | (1R)-N-[5-(1,3-benzodioxol-5-ylmethyl)-4-methyl-1,3-thiazol-2-yl]-2,2-dichlorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 29427798 |
| Molecular Formula | C16H14Cl2N2O3S |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | (1R)-N-[5-(1,3-benzodioxol-5-ylmethyl)-4-methyl-1,3-thiazol-2-yl]-2,2-dichlorocyclopropane-1-carboxamide |
| SMILES | Cc1nc(NC(=O)[C@H]2CC2(Cl)Cl)sc1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H14Cl2N2O3S/c1-8-13(5-9-2-3-11-12(4-9)23-7-22-11)24-15(19-8)20-14(21)10-6-16(10,17)18/h2-4,10H,5-7H2,1H3,(H,19,20,21)/t10-/m1/s1 |
| InChIKey | JPOHWDXACATEQT-SNVBAGLBSA-N |
| XLogP | 3.90 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|