C17H19ClN2O3S — CID 141495352
N-[5-(1,3-benzodioxol-5-ylmethyl)-4-tert-butyl-1,3-thiazol-2-yl]-2-chloroacetamide (PubChem CID 141495352) has the molecular formula C17H19ClN2O3S and a molecular weight of 366.87 g/mol. Its IUPAC name is N-[5-(1,3-benzodioxol-5-ylmethyl)-4-tert-butyl-1,3-thiazol-2-yl]-2-chloroacetamide.
| Compound Name | N-[5-(1,3-benzodioxol-5-ylmethyl)-4-tert-butyl-1,3-thiazol-2-yl]-2-chloroacetamide |
|---|---|
| PubChem CID | 141495352 |
| Molecular Formula | C17H19ClN2O3S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | N-[5-(1,3-benzodioxol-5-ylmethyl)-4-tert-butyl-1,3-thiazol-2-yl]-2-chloroacetamide |
| SMILES | CC(C)(C)c1nc(NC(=O)CCl)sc1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H19ClN2O3S/c1-17(2,3)15-13(24-16(20-15)19-14(21)8-18)7-10-4-5-11-12(6-10)23-9-22-11/h4-6H,7-9H2,1-3H3,(H,19,20,21) |
| InChIKey | LCDBPVVIEPUVTE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|