C16H20N2O3S — CID 90929242
2-[2-(2,3-diethylphenyl)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate (PubChem CID 90929242) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 2-[2-(2,3-diethylphenyl)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate.
| Compound Name | 2-[2-(2,3-diethylphenyl)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate |
|---|---|
| PubChem CID | 90929242 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-[2-(2,3-diethylphenyl)-4-methyl-1,3-thiazol-5-yl]ethyl nitrate |
| SMILES | CCc1cccc(-c2nc(C)c(CCO[N+](=O)[O-])s2)c1CC |
| InChI | InChI=1S/C16H20N2O3S/c1-4-12-7-6-8-14(13(12)5-2)16-17-11(3)15(22-16)9-10-21-18(19)20/h6-8H,4-5,9-10H2,1-3H3 |
| InChIKey | HBWKGTKEFABJOF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|