C15H20N2O6 — CID 168971123
[5-[1-(1,3-benzodioxol-5-yl)propan-2-ylamino]-5-oxopentyl] nitrate (PubChem CID 168971123) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is [5-[1-(1,3-benzodioxol-5-yl)propan-2-ylamino]-5-oxopentyl] nitrate.
| Compound Name | [5-[1-(1,3-benzodioxol-5-yl)propan-2-ylamino]-5-oxopentyl] nitrate |
|---|---|
| PubChem CID | 168971123 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | [5-[1-(1,3-benzodioxol-5-yl)propan-2-ylamino]-5-oxopentyl] nitrate |
| SMILES | CC(Cc1ccc2c(c1)OCO2)NC(=O)CCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N2O6/c1-11(16-15(18)4-2-3-7-23-17(19)20)8-12-5-6-13-14(9-12)22-10-21-13/h5-6,9,11H,2-4,7-8,10H2,1H3,(H,16,18) |
| InChIKey | DDCSOARZHSQFJA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|