C14H21N2O6+ — CID 168971126
[4-[[(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl]amino]-4-oxobutoxy]-hydroxy-oxoazanium;molecular hydrogen (PubChem CID 168971126) has the molecular formula C14H21N2O6+ and a molecular weight of 313.33 g/mol. Its IUPAC name is [4-[[(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl]amino]-4-oxobutoxy]-hydroxy-oxoazanium;molecular hydrogen.
| Compound Name | [4-[[(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl]amino]-4-oxobutoxy]-hydroxy-oxoazanium;molecular hydrogen |
|---|---|
| PubChem CID | 168971126 |
| Molecular Formula | C14H21N2O6+ |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | [4-[[(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl]amino]-4-oxobutoxy]-hydroxy-oxoazanium;molecular hydrogen |
| SMILES | C[C@@H](Cc1ccc2c(c1)OCO2)NC(=O)CCCO[N+](=O)O.[H][H] |
| InChI | InChI=1S/C14H18N2O6.H2/c1-10(15-14(17)3-2-6-22-16(18)19)7-11-4-5-12-13(8-11)21-9-20-12;/h4-5,8,10H,2-3,6-7,9H2,1H3,(H-,15,17,18,19);1H/p+1/t10-;/m0./s1 |
| InChIKey | IDQATUTUNQXGPE-PPHPATTJSA-O |
| XLogP | 1.59 |
| TPSA | 97.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|