C9H19N2O4+ — CID 90390531
(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)oxy-methoxy-oxoazanium (PubChem CID 90390531) has the molecular formula C9H19N2O4+ and a molecular weight of 219.26 g/mol. Its IUPAC name is (1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)oxy-methoxy-oxoazanium.
| Compound Name | (1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)oxy-methoxy-oxoazanium |
|---|---|
| PubChem CID | 90390531 |
| Molecular Formula | C9H19N2O4+ |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)oxy-methoxy-oxoazanium |
| SMILES | CO[N+](=O)OC1CC(C)(C)N(O)C1(C)C |
| InChI | InChI=1S/C9H19N2O4/c1-8(2)6-7(15-11(13)14-5)9(3,4)10(8)12/h7,12H,6H2,1-5H3/q+1 |
| InChIKey | RWVLYQODZVVPNB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 62.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|