C9H18N2O3 — CID 141421485
(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl nitrate (PubChem CID 141421485) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is (2,2,5,5-tetramethylpyrrolidin-3-yl)methyl nitrate.
| Compound Name | (2,2,5,5-tetramethylpyrrolidin-3-yl)methyl nitrate |
|---|---|
| PubChem CID | 141421485 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | (2,2,5,5-tetramethylpyrrolidin-3-yl)methyl nitrate |
| SMILES | CC1(C)CC(CO[N+](=O)[O-])C(C)(C)N1 |
| InChI | InChI=1S/C9H18N2O3/c1-8(2)5-7(6-14-11(12)13)9(3,4)10-8/h7,10H,5-6H2,1-4H3 |
| InChIKey | NKIFTQNHSQGQGM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|