(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl nitrate

C9H18N2O3 — CID 141421485

IUPAC(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl nitrate
SMILESCC1(C)CC(CO[N+](=O)[O-])C(C)(C)N1
InChIInChI=1S/C9H18N2O3/c1-8(2)5-7(6-14-11(12)13)9(3,4)10-8/h7,10H,5-6H2,1-4H3
InChIKeyNKIFTQNHSQGQGM-UHFFFAOYSA-N
MW202.25 g/mol
LogP1.36
Rot. Bonds3

About (2,2,5,5-tetramethylpyrrolidin-3-yl)methyl nitrate

(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl nitrate (PubChem CID 141421485) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is (2,2,5,5-tetramethylpyrrolidin-3-yl)methyl nitrate.

Molecular Properties

Compound Name(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl nitrate
PubChem CID141421485
Molecular FormulaC9H18N2O3
Molecular Weight202.25 g/mol
Exact Mass202.13
IUPAC Name(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl nitrate
SMILESCC1(C)CC(CO[N+](=O)[O-])C(C)(C)N1
InChIInChI=1S/C9H18N2O3/c1-8(2)5-7(6-14-11(12)13)9(3,4)10-8/h7,10H,5-6H2,1-4H3
InChIKeyNKIFTQNHSQGQGM-UHFFFAOYSA-N
XLogP1.36
TPSA64.40 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.25
LogP ≤ 51.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2,2,5,5-tetramethylpyrrolidin-3-yl)methyl nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,2,5,5-tetramethylpyrrolidin-3-yl)methyl nitrate?
The IUPAC name of (2,2,5,5-tetramethylpyrrolidin-3-yl)methyl nitrate (CID 141421485) is (2,2,5,5-tetramethylpyrrolidin-3-yl)methyl nitrate.
What is the SMILES notation for (2,2,5,5-tetramethylpyrrolidin-3-yl)methyl nitrate?
The canonical SMILES for (2,2,5,5-tetramethylpyrrolidin-3-yl)methyl nitrate is CC1(C)CC(CO[N+](=O)[O-])C(C)(C)N1.
What is the InChIKey of (2,2,5,5-tetramethylpyrrolidin-3-yl)methyl nitrate?
The InChIKey is NKIFTQNHSQGQGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O3/c1-8(2)5-7(6-14-11(12)13)9(3,4)10-8/h7,10H,5-6H2,1-4H3.
What are the key properties of (2,2,5,5-tetramethylpyrrolidin-3-yl)methyl nitrate?
(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl nitrate has a molecular weight of 202.25 g/mol, XLogP of 1.36, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2,5,5-tetramethylpyrrolidin-3-yl)methyl nitrate is sourced from PubChem (CID 141421485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).