C14H26N2O5 — CID 85470471
[2,2,6,6-tetramethyl-3-(nitrooxymethyl)piperidin-1-yl] 2-methylpropanoate (PubChem CID 85470471) has the molecular formula C14H26N2O5 and a molecular weight of 302.37 g/mol. Its IUPAC name is [2,2,6,6-tetramethyl-3-(nitrooxymethyl)piperidin-1-yl] 2-methylpropanoate.
| Compound Name | [2,2,6,6-tetramethyl-3-(nitrooxymethyl)piperidin-1-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 85470471 |
| Molecular Formula | C14H26N2O5 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | [2,2,6,6-tetramethyl-3-(nitrooxymethyl)piperidin-1-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)ON1C(C)(C)CCC(CO[N+](=O)[O-])C1(C)C |
| InChI | InChI=1S/C14H26N2O5/c1-10(2)12(17)21-15-13(3,4)8-7-11(14(15,5)6)9-20-16(18)19/h10-11H,7-9H2,1-6H3 |
| InChIKey | ZLZYKKOEYWMISD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|