C11H20N2O6 — CID 177386746
[(3R,4S,5R)-4-methyl-4-nitro-5-pentyloxolan-3-yl]methyl nitrate (PubChem CID 177386746) has the molecular formula C11H20N2O6 and a molecular weight of 276.29 g/mol. Its IUPAC name is [(3R,4S,5R)-4-methyl-4-nitro-5-pentyloxolan-3-yl]methyl nitrate.
| Compound Name | [(3R,4S,5R)-4-methyl-4-nitro-5-pentyloxolan-3-yl]methyl nitrate |
|---|---|
| PubChem CID | 177386746 |
| Molecular Formula | C11H20N2O6 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | [(3R,4S,5R)-4-methyl-4-nitro-5-pentyloxolan-3-yl]methyl nitrate |
| SMILES | CCCCC[C@H]1OC[C@H](CO[N+](=O)[O-])[C@]1(C)[N+](=O)[O-] |
| InChI | InChI=1S/C11H20N2O6/c1-3-4-5-6-10-11(2,12(14)15)9(7-18-10)8-19-13(16)17/h9-10H,3-8H2,1-2H3/t9-,10-,11+/m1/s1 |
| InChIKey | YIKRNKWZICBQAE-MXWKQRLJSA-N |
| XLogP | 1.83 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|