C13H23NO3 — CID 102328999
(4R,5S)-2,2,4-trimethyl-3-methylidene-4-nitro-5-pentyloxolane (PubChem CID 102328999) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is (4R,5S)-2,2,4-trimethyl-3-methylidene-4-nitro-5-pentyloxolane.
| Compound Name | (4R,5S)-2,2,4-trimethyl-3-methylidene-4-nitro-5-pentyloxolane |
|---|---|
| PubChem CID | 102328999 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | (4R,5S)-2,2,4-trimethyl-3-methylidene-4-nitro-5-pentyloxolane |
| SMILES | C=C1C(C)(C)O[C@@H](CCCCC)[C@]1(C)[N+](=O)[O-] |
| InChI | InChI=1S/C13H23NO3/c1-6-7-8-9-11-13(5,14(15)16)10(2)12(3,4)17-11/h11H,2,6-9H2,1,3-5H3/t11-,13+/m0/s1 |
| InChIKey | GSNIJQWVVFIXNP-WCQYABFASA-N |
| XLogP | 3.34 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|