C8H14O2 — CID 56981326
2-pentyl-1,4-dioxaspiro[2.2]pentane (PubChem CID 56981326) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is 2-pentyl-1,4-dioxaspiro[2.2]pentane.
| Compound Name | 2-pentyl-1,4-dioxaspiro[2.2]pentane |
|---|---|
| PubChem CID | 56981326 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 2-pentyl-1,4-dioxaspiro[2.2]pentane |
| SMILES | CCCCCC1OC12CO2 |
| InChI | InChI=1S/C8H14O2/c1-2-3-4-5-7-8(10-7)6-9-8/h7H,2-6H2,1H3 |
| InChIKey | MTMPWNNZMSLRQD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|