C11H23ClOSi — CID 11128263
[(2S,3S)-2-chloro-3-hexyloxiran-2-yl]-trimethylsilane (PubChem CID 11128263) has the molecular formula C11H23ClOSi and a molecular weight of 234.84 g/mol. Its IUPAC name is [(2S,3S)-2-chloro-3-hexyloxiran-2-yl]-trimethylsilane.
| Compound Name | [(2S,3S)-2-chloro-3-hexyloxiran-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 11128263 |
| Molecular Formula | C11H23ClOSi |
| Molecular Weight | 234.84 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | [(2S,3S)-2-chloro-3-hexyloxiran-2-yl]-trimethylsilane |
| SMILES | CCCCCC[C@@H]1O[C@]1(Cl)[Si](C)(C)C |
| InChI | InChI=1S/C11H23ClOSi/c1-5-6-7-8-9-10-11(12,13-10)14(2,3)4/h10H,5-9H2,1-4H3/t10-,11-/m0/s1 |
| InChIKey | SPVWSCQXQHMZGK-QWRGUYRKSA-N |
| XLogP | 4.17 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.84 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|