C19H36O2 — CID 22957637
2,5-dioctyl-1,4-dioxaspiro[2.2]pentane (PubChem CID 22957637) has the molecular formula C19H36O2 and a molecular weight of 296.49 g/mol. Its IUPAC name is 2,5-dioctyl-1,4-dioxaspiro[2.2]pentane.
| Compound Name | 2,5-dioctyl-1,4-dioxaspiro[2.2]pentane |
|---|---|
| PubChem CID | 22957637 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.49 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | 2,5-dioctyl-1,4-dioxaspiro[2.2]pentane |
| SMILES | CCCCCCCCC1OC12OC2CCCCCCCC |
| InChI | InChI=1S/C19H36O2/c1-3-5-7-9-11-13-15-17-19(20-17)18(21-19)16-14-12-10-8-6-4-2/h17-18H,3-16H2,1-2H3 |
| InChIKey | LJVLCWIABGCKDR-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.49 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|