C7H11NO5 — CID 156874466
[(3aR,6S,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]methyl nitrate (PubChem CID 156874466) has the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. Its IUPAC name is [(3aR,6S,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]methyl nitrate.
| Compound Name | [(3aR,6S,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]methyl nitrate |
|---|---|
| PubChem CID | 156874466 |
| Molecular Formula | C7H11NO5 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | [(3aR,6S,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]methyl nitrate |
| SMILES | O=[N+]([O-])OC[C@@H]1CO[C@@H]2CCO[C@H]12 |
| InChI | InChI=1S/C7H11NO5/c9-8(10)13-4-5-3-12-6-1-2-11-7(5)6/h5-7H,1-4H2/t5-,6+,7+/m0/s1 |
| InChIKey | KXDFCKBZSRGHKS-RRKCRQDMSA-N |
| XLogP | -0.00 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|