C11H18N2O7 — CID 156874465
[(3aR,6S,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]methyl nitrate;acetylene;2-aminoacetic acid (PubChem CID 156874465) has the molecular formula C11H18N2O7 and a molecular weight of 290.27 g/mol. Its IUPAC name is [(3aR,6S,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]methyl nitrate;acetylene;2-aminoacetic acid.
| Compound Name | [(3aR,6S,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]methyl nitrate;acetylene;2-aminoacetic acid |
|---|---|
| PubChem CID | 156874465 |
| Molecular Formula | C11H18N2O7 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | [(3aR,6S,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]methyl nitrate;acetylene;2-aminoacetic acid |
| SMILES | C#C.NCC(=O)O.O=[N+]([O-])OC[C@@H]1CO[C@@H]2CCO[C@H]12 |
| InChI | InChI=1S/C7H11NO5.C2H5NO2.C2H2/c9-8(10)13-4-5-3-12-6-1-2-11-7(5)6;3-1-2(4)5;1-2/h5-7H,1-4H2;1,3H2,(H,4,5);1-2H/t5-,6+,7+;;/m0../s1 |
| InChIKey | LTCIRNWRSWJAMY-OJSHLMAWSA-N |
| XLogP | -0.72 |
| TPSA | 134.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|