C15H28N2O6 — CID 156874460
[(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate;acetylene;4-amino-2-methylhexan-2-ol (PubChem CID 156874460) has the molecular formula C15H28N2O6 and a molecular weight of 332.40 g/mol. Its IUPAC name is [(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate;acetylene;4-amino-2-methylhexan-2-ol.
| Compound Name | [(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate;acetylene;4-amino-2-methylhexan-2-ol |
|---|---|
| PubChem CID | 156874460 |
| Molecular Formula | C15H28N2O6 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | [(3aR,6R,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate;acetylene;4-amino-2-methylhexan-2-ol |
| SMILES | C#C.CCC(N)CC(C)(C)O.O=[N+]([O-])O[C@@H]1CO[C@@H]2CCO[C@@H]21 |
| InChI | InChI=1S/C7H17NO.C6H9NO5.C2H2/c1-4-6(8)5-7(2,3)9;8-7(9)12-5-3-11-4-1-2-10-6(4)5;1-2/h6,9H,4-5,8H2,1-3H3;4-6H,1-3H2;1-2H/t;4-,5-,6+;/m.1./s1 |
| InChIKey | VQOWSZDJHUFWDG-NFHWRYQUSA-N |
| XLogP | 0.89 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|