C11H17ClN2O9 — CID 11314297
(2S)-5-[[(3aR,6R,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-2-amino-5-oxopentanoic acid;hydrochloride (PubChem CID 11314297) has the molecular formula C11H17ClN2O9 and a molecular weight of 356.72 g/mol. Its IUPAC name is (2S)-5-[[(3aR,6R,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-2-amino-5-oxopentanoic acid;hydrochloride.
| Compound Name | (2S)-5-[[(3aR,6R,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-2-amino-5-oxopentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 11314297 |
| Molecular Formula | C11H17ClN2O9 |
| Molecular Weight | 356.72 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | (2S)-5-[[(3aR,6R,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-2-amino-5-oxopentanoic acid;hydrochloride |
| SMILES | Cl.N[C@@H](CCC(=O)OC1CO[C@H]2[C@@H]1OC[C@H]2O[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C11H16N2O9.ClH/c12-5(11(15)16)1-2-8(14)21-6-3-19-10-7(22-13(17)18)4-20-9(6)10;/h5-7,9-10H,1-4,12H2,(H,15,16);1H/t5-,6?,7+,9+,10+;/m0./s1 |
| InChIKey | QGACHAYPXKJYAG-CXIRIWRQSA-N |
| XLogP | -1.11 |
| TPSA | 160.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.72 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|