C20H31N3O14 — CID 137357588
5-O-[(3R,3aR,6R,6aR)-3-(5,6-dinitrooxyhexanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 1-O-propan-2-yl 2-aminopentanedioate (PubChem CID 137357588) has the molecular formula C20H31N3O14 and a molecular weight of 537.48 g/mol. Its IUPAC name is 5-O-[(3R,3aR,6R,6aR)-3-(5,6-dinitrooxyhexanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 1-O-propan-2-yl 2-aminopentanedioate.
| Compound Name | 5-O-[(3R,3aR,6R,6aR)-3-(5,6-dinitrooxyhexanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 1-O-propan-2-yl 2-aminopentanedioate |
|---|---|
| PubChem CID | 137357588 |
| Molecular Formula | C20H31N3O14 |
| Molecular Weight | 537.48 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | 5-O-[(3R,3aR,6R,6aR)-3-(5,6-dinitrooxyhexanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 1-O-propan-2-yl 2-aminopentanedioate |
| SMILES | CC(C)OC(=O)C(N)CCC(=O)O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)CCCC(CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C20H31N3O14/c1-11(2)34-20(26)13(21)6-7-17(25)36-15-10-32-18-14(9-31-19(15)18)35-16(24)5-3-4-12(37-23(29)30)8-33-22(27)28/h11-15,18-19H,3-10,21H2,1-2H3/t12?,13?,14-,15-,18-,19-/m1/s1 |
| InChIKey | SBKLVHHJVYCYCN-HXWFKCQDSA-N |
| XLogP | -0.38 |
| TPSA | 228.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.48 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|