C17H26N2O13 — CID 137357652
[3-[3-(2,3-dinitrooxypropoxy)propanoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2,2-dimethylpropanoate (PubChem CID 137357652) has the molecular formula C17H26N2O13 and a molecular weight of 466.40 g/mol. Its IUPAC name is [3-[3-(2,3-dinitrooxypropoxy)propanoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2,2-dimethylpropanoate.
| Compound Name | [3-[3-(2,3-dinitrooxypropoxy)propanoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 137357652 |
| Molecular Formula | C17H26N2O13 |
| Molecular Weight | 466.40 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | [3-[3-(2,3-dinitrooxypropoxy)propanoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC1COC2C(OC(=O)CCOCC(CO[N+](=O)[O-])O[N+](=O)[O-])COC12 |
| InChI | InChI=1S/C17H26N2O13/c1-17(2,3)16(21)31-12-9-28-14-11(8-27-15(12)14)30-13(20)4-5-26-6-10(32-19(24)25)7-29-18(22)23/h10-12,14-15H,4-9H2,1-3H3 |
| InChIKey | WMBRAUBCNQVAGQ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 185.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.40 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|