C18H21N3O12 — CID 137357611
[(3R,3aR,6R,6aR)-3-(5,6-dinitrooxyhexanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] pyridine-3-carboxylate (PubChem CID 137357611) has the molecular formula C18H21N3O12 and a molecular weight of 471.38 g/mol. Its IUPAC name is [(3R,3aR,6R,6aR)-3-(5,6-dinitrooxyhexanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] pyridine-3-carboxylate.
| Compound Name | [(3R,3aR,6R,6aR)-3-(5,6-dinitrooxyhexanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 137357611 |
| Molecular Formula | C18H21N3O12 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | [(3R,3aR,6R,6aR)-3-(5,6-dinitrooxyhexanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] pyridine-3-carboxylate |
| SMILES | O=C(CCCC(CO[N+](=O)[O-])O[N+](=O)[O-])O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)c1cccnc1 |
| InChI | InChI=1S/C18H21N3O12/c22-15(5-1-4-12(33-21(26)27)8-30-20(24)25)31-13-9-28-17-14(10-29-16(13)17)32-18(23)11-3-2-6-19-7-11/h2-3,6-7,12-14,16-17H,1,4-5,8-10H2/t12?,13-,14-,16-,17-/m1/s1 |
| InChIKey | CXHWLHKDLGBHHG-OYSNRLPKSA-N |
| XLogP | 0.27 |
| TPSA | 188.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|