C17H26N2O12 — CID 58209453
[(3S,3aR,6S,6aR)-3-(oxan-2-yloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (5R)-5,6-dinitrooxyhexanoate (PubChem CID 58209453) has the molecular formula C17H26N2O12 and a molecular weight of 450.40 g/mol. Its IUPAC name is [(3S,3aR,6S,6aR)-3-(oxan-2-yloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (5R)-5,6-dinitrooxyhexanoate.
| Compound Name | [(3S,3aR,6S,6aR)-3-(oxan-2-yloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (5R)-5,6-dinitrooxyhexanoate |
|---|---|
| PubChem CID | 58209453 |
| Molecular Formula | C17H26N2O12 |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | [(3S,3aR,6S,6aR)-3-(oxan-2-yloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (5R)-5,6-dinitrooxyhexanoate |
| SMILES | O=C(CCC[C@H](CO[N+](=O)[O-])O[N+](=O)[O-])O[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2OC1CCCCO1 |
| InChI | InChI=1S/C17H26N2O12/c20-14(5-3-4-11(31-19(23)24)8-28-18(21)22)29-12-9-26-17-13(10-27-16(12)17)30-15-6-1-2-7-25-15/h11-13,15-17H,1-10H2/t11-,12+,13+,15?,16-,17-/m1/s1 |
| InChIKey | VVUPDUNRXPZUMR-KTBVHRJESA-N |
| XLogP | 0.56 |
| TPSA | 167.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|