C17H31N5O21 — CID 157430124
6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;[2-(methoxymethyl)-2-(nitromethoxy)-3-nitrooxypropyl] nitrate;(1-methoxy-3-nitrooxypropan-2-yl) nitrate (PubChem CID 157430124) has the molecular formula C17H31N5O21 and a molecular weight of 641.45 g/mol. Its IUPAC name is 6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;[2-(methoxymethyl)-2-(nitromethoxy)-3-nitrooxypropyl] nitrate;(1-methoxy-3-nitrooxypropan-2-yl) nitrate.
| Compound Name | 6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;[2-(methoxymethyl)-2-(nitromethoxy)-3-nitrooxypropyl] nitrate;(1-methoxy-3-nitrooxypropan-2-yl) nitrate |
|---|---|
| PubChem CID | 157430124 |
| Molecular Formula | C17H31N5O21 |
| Molecular Weight | 641.45 g/mol |
| Exact Mass | 641.15 |
| IUPAC Name | 6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol;[2-(methoxymethyl)-2-(nitromethoxy)-3-nitrooxypropyl] nitrate;(1-methoxy-3-nitrooxypropan-2-yl) nitrate |
| SMILES | COC1COC2C(O)COC12.COCC(CO[N+](=O)[O-])(CO[N+](=O)[O-])OC[N+](=O)[O-].COCC(CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C7H12O4.C6H11N3O10.C4H8N2O7/c1-9-5-3-11-6-4(8)2-10-7(5)6;1-16-2-6(3-18-8(12)13,4-19-9(14)15)17-5-7(10)11;1-11-2-4(13-6(9)10)3-12-5(7)8/h4-8H,2-3H2,1H3;2-5H2,1H3;4H,2-3H2,1H3 |
| InChIKey | BQKTWHPUBKEXBE-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 328.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.45 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|